C14H8Cl2N8O — CID 11538041
5-N,6-N-bis(6-chloro-3-pyridinyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine (PubChem CID 11538041) has the molecular formula C14H8Cl2N8O and a molecular weight of 375.18 g/mol. Its IUPAC name is 5-N,6-N-bis(6-chloro-3-pyridinyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine.
| Compound Name | 5-N,6-N-bis(6-chloro-3-pyridinyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
|---|---|
| PubChem CID | 11538041 |
| Molecular Formula | C14H8Cl2N8O |
| Molecular Weight | 375.18 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | 5-N,6-N-bis(6-chloro-3-pyridinyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
| SMILES | Clc1ccc(Nc2nc3nonc3nc2Nc2ccc(Cl)nc2)cn1 |
| InChI | InChI=1S/C14H8Cl2N8O/c15-9-3-1-7(5-17-9)19-11-12(20-8-2-4-10(16)18-6-8)22-14-13(21-11)23-25-24-14/h1-6H,(H,19,21,23)(H,20,22,24) |
| InChIKey | ZGAJCWCCEWXTBB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.18 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|