C11H15BrN2OS — CID 115380568
2-(3-bromothiophen-2-yl)-2-(cyclopentylamino)acetamide (PubChem CID 115380568) has the molecular formula C11H15BrN2OS and a molecular weight of 303.23 g/mol. Its IUPAC name is 2-(3-bromothiophen-2-yl)-2-(cyclopentylamino)acetamide.
| Compound Name | 2-(3-bromothiophen-2-yl)-2-(cyclopentylamino)acetamide |
|---|---|
| PubChem CID | 115380568 |
| Molecular Formula | C11H15BrN2OS |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 2-(3-bromothiophen-2-yl)-2-(cyclopentylamino)acetamide |
| SMILES | NC(=O)C(NC1CCCC1)c1sccc1Br |
| InChI | InChI=1S/C11H15BrN2OS/c12-8-5-6-16-10(8)9(11(13)15)14-7-3-1-2-4-7/h5-7,9,14H,1-4H2,(H2,13,15) |
| InChIKey | RPEGNJWHNWRCNM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |