C14H17Br2N3S — CID 115381195
5-bromo-2-(3-bromothiophen-2-yl)-N,6-dipropylpyrimidin-4-amine (PubChem CID 115381195) has the molecular formula C14H17Br2N3S and a molecular weight of 419.19 g/mol. Its IUPAC name is 5-bromo-2-(3-bromothiophen-2-yl)-N,6-dipropylpyrimidin-4-amine.
| Compound Name | 5-bromo-2-(3-bromothiophen-2-yl)-N,6-dipropylpyrimidin-4-amine |
|---|---|
| PubChem CID | 115381195 |
| Molecular Formula | C14H17Br2N3S |
| Molecular Weight | 419.19 g/mol |
| Exact Mass | 416.95 |
| IUPAC Name | 5-bromo-2-(3-bromothiophen-2-yl)-N,6-dipropylpyrimidin-4-amine |
| SMILES | CCCNc1nc(-c2sccc2Br)nc(CCC)c1Br |
| InChI | InChI=1S/C14H17Br2N3S/c1-3-5-10-11(16)13(17-7-4-2)19-14(18-10)12-9(15)6-8-20-12/h6,8H,3-5,7H2,1-2H3,(H,17,18,19) |
| InChIKey | FTRZIJGMHFRRNF-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.19 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |