C11H16BrNS — CID 115381593
(E)-3-(3-bromothiophen-2-yl)-2-methyl-N-propylprop-2-en-1-amine (PubChem CID 115381593) has the molecular formula C11H16BrNS and a molecular weight of 274.23 g/mol. Its IUPAC name is (E)-3-(3-bromothiophen-2-yl)-2-methyl-N-propylprop-2-en-1-amine.
| Compound Name | (E)-3-(3-bromothiophen-2-yl)-2-methyl-N-propylprop-2-en-1-amine |
|---|---|
| PubChem CID | 115381593 |
| Molecular Formula | C11H16BrNS |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | (E)-3-(3-bromothiophen-2-yl)-2-methyl-N-propylprop-2-en-1-amine |
| SMILES | CCCNC/C(C)=C/c1sccc1Br |
| InChI | InChI=1S/C11H16BrNS/c1-3-5-13-8-9(2)7-11-10(12)4-6-14-11/h4,6-7,13H,3,5,8H2,1-2H3/b9-7+ |
| InChIKey | ZMKOFNFNYDQFHM-VQHVLOKHSA-N |
| XLogP | 3.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|