2-(1,3-benzoxazol-2-ylmethylsulfanyl)-4-bromobenzoic acid

C15H10BrNO3S — CID 115381966

IUPAC2-(1,3-benzoxazol-2-ylmethylsulfanyl)-4-bromobenzoic acid
SMILESO=C(O)c1ccc(Br)cc1SCc1nc2ccccc2o1
InChIInChI=1S/C15H10BrNO3S/c16-9-5-6-10(15(18)19)13(7-9)21-8-14-17-11-3-1-2-4-12(11)20-14/h1-7H,8H2,(H,18,19)
InChIKeyKXPOWBXEDNLTDQ-UHFFFAOYSA-N
MW364.22 g/mol
LogP4.58
Rot. Bonds4

About 2-(1,3-benzoxazol-2-ylmethylsulfanyl)-4-bromobenzoic acid

2-(1,3-benzoxazol-2-ylmethylsulfanyl)-4-bromobenzoic acid (PubChem CID 115381966) has the molecular formula C15H10BrNO3S and a molecular weight of 364.22 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylmethylsulfanyl)-4-bromobenzoic acid.

Molecular Properties

Compound Name2-(1,3-benzoxazol-2-ylmethylsulfanyl)-4-bromobenzoic acid
PubChem CID115381966
Molecular FormulaC15H10BrNO3S
Molecular Weight364.22 g/mol
Exact Mass362.96
IUPAC Name2-(1,3-benzoxazol-2-ylmethylsulfanyl)-4-bromobenzoic acid
SMILESO=C(O)c1ccc(Br)cc1SCc1nc2ccccc2o1
InChIInChI=1S/C15H10BrNO3S/c16-9-5-6-10(15(18)19)13(7-9)21-8-14-17-11-3-1-2-4-12(11)20-14/h1-7H,8H2,(H,18,19)
InChIKeyKXPOWBXEDNLTDQ-UHFFFAOYSA-N
XLogP4.58
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500364.22
LogP ≤ 54.58
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(1,3-benzoxazol-2-ylmethylsulfanyl)-4-bromobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,3-benzoxazol-2-ylmethylsulfanyl)-4-bromobenzoic acid?
The IUPAC name of 2-(1,3-benzoxazol-2-ylmethylsulfanyl)-4-bromobenzoic acid (CID 115381966) is 2-(1,3-benzoxazol-2-ylmethylsulfanyl)-4-bromobenzoic acid.
What is the SMILES notation for 2-(1,3-benzoxazol-2-ylmethylsulfanyl)-4-bromobenzoic acid?
The canonical SMILES for 2-(1,3-benzoxazol-2-ylmethylsulfanyl)-4-bromobenzoic acid is O=C(O)c1ccc(Br)cc1SCc1nc2ccccc2o1.
What is the InChIKey of 2-(1,3-benzoxazol-2-ylmethylsulfanyl)-4-bromobenzoic acid?
The InChIKey is KXPOWBXEDNLTDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10BrNO3S/c16-9-5-6-10(15(18)19)13(7-9)21-8-14-17-11-3-1-2-4-12(11)20-14/h1-7H,8H2,(H,18,19).
What are the key properties of 2-(1,3-benzoxazol-2-ylmethylsulfanyl)-4-bromobenzoic acid?
2-(1,3-benzoxazol-2-ylmethylsulfanyl)-4-bromobenzoic acid has a molecular weight of 364.22 g/mol, XLogP of 4.58, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzoxazol-2-ylmethylsulfanyl)-4-bromobenzoic acid is sourced from PubChem (CID 115381966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).