C16H19BrO3S — CID 115381992
4-bromo-2-(6-oxaspiro[4.5]decan-9-ylsulfanyl)benzoic acid (PubChem CID 115381992) has the molecular formula C16H19BrO3S and a molecular weight of 371.30 g/mol. Its IUPAC name is 4-bromo-2-(6-oxaspiro[4.5]decan-9-ylsulfanyl)benzoic acid.
| Compound Name | 4-bromo-2-(6-oxaspiro[4.5]decan-9-ylsulfanyl)benzoic acid |
|---|---|
| PubChem CID | 115381992 |
| Molecular Formula | C16H19BrO3S |
| Molecular Weight | 371.30 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | 4-bromo-2-(6-oxaspiro[4.5]decan-9-ylsulfanyl)benzoic acid |
| SMILES | O=C(O)c1ccc(Br)cc1SC1CCOC2(CCCC2)C1 |
| InChI | InChI=1S/C16H19BrO3S/c17-11-3-4-13(15(18)19)14(9-11)21-12-5-8-20-16(10-12)6-1-2-7-16/h3-4,9,12H,1-2,5-8,10H2,(H,18,19) |
| InChIKey | RAHANOOKBZQQSN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.30 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |