C14H8BrN3O2S — CID 115382335
4-bromo-2-pyrido[2,3-b]pyrazin-6-ylsulfanylbenzoic acid (PubChem CID 115382335) has the molecular formula C14H8BrN3O2S and a molecular weight of 362.21 g/mol. Its IUPAC name is 4-bromo-2-pyrido[2,3-b]pyrazin-6-ylsulfanylbenzoic acid.
| Compound Name | 4-bromo-2-pyrido[2,3-b]pyrazin-6-ylsulfanylbenzoic acid |
|---|---|
| PubChem CID | 115382335 |
| Molecular Formula | C14H8BrN3O2S |
| Molecular Weight | 362.21 g/mol |
| Exact Mass | 360.95 |
| IUPAC Name | 4-bromo-2-pyrido[2,3-b]pyrazin-6-ylsulfanylbenzoic acid |
| SMILES | O=C(O)c1ccc(Br)cc1Sc1ccc2nccnc2n1 |
| InChI | InChI=1S/C14H8BrN3O2S/c15-8-1-2-9(14(19)20)11(7-8)21-12-4-3-10-13(18-12)17-6-5-16-10/h1-7H,(H,19,20) |
| InChIKey | ANQDQNPEWFTYDU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.21 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |