C7H9BrN2O2S3 — CID 115382603
methyl 2-bromo-3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate (PubChem CID 115382603) has the molecular formula C7H9BrN2O2S3 and a molecular weight of 329.27 g/mol. Its IUPAC name is methyl 2-bromo-3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate.
| Compound Name | methyl 2-bromo-3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate |
|---|---|
| PubChem CID | 115382603 |
| Molecular Formula | C7H9BrN2O2S3 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 327.90 |
| IUPAC Name | methyl 2-bromo-3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]propanoate |
| SMILES | COC(=O)C(Br)CSc1nnc(SC)s1 |
| InChI | InChI=1S/C7H9BrN2O2S3/c1-12-5(11)4(8)3-14-7-10-9-6(13-2)15-7/h4H,3H2,1-2H3 |
| InChIKey | JTJYFSADDPZANG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|