C9H16N4S3 — CID 115383063
2,2-dimethyl-4-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]butanimidamide (PubChem CID 115383063) has the molecular formula C9H16N4S3 and a molecular weight of 276.46 g/mol. Its IUPAC name is 2,2-dimethyl-4-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]butanimidamide.
| Compound Name | 2,2-dimethyl-4-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]butanimidamide |
|---|---|
| PubChem CID | 115383063 |
| Molecular Formula | C9H16N4S3 |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 2,2-dimethyl-4-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]butanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCSc1nnc(SC)s1 |
| InChI | InChI=1S/C9H16N4S3/c1-9(2,6(10)11)4-5-15-8-13-12-7(14-3)16-8/h4-5H2,1-3H3,(H3,10,11) |
| InChIKey | MPNMYIVYPXRAOH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 75.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|