C7H5IN4S3 — CID 115383283
2-(5-iodopyrimidin-4-yl)sulfanyl-5-methylsulfanyl-1,3,4-thiadiazole (PubChem CID 115383283) has the molecular formula C7H5IN4S3 and a molecular weight of 368.25 g/mol. Its IUPAC name is 2-(5-iodopyrimidin-4-yl)sulfanyl-5-methylsulfanyl-1,3,4-thiadiazole.
| Compound Name | 2-(5-iodopyrimidin-4-yl)sulfanyl-5-methylsulfanyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 115383283 |
| Molecular Formula | C7H5IN4S3 |
| Molecular Weight | 368.25 g/mol |
| Exact Mass | 367.87 |
| IUPAC Name | 2-(5-iodopyrimidin-4-yl)sulfanyl-5-methylsulfanyl-1,3,4-thiadiazole |
| SMILES | CSc1nnc(Sc2ncncc2I)s1 |
| InChI | InChI=1S/C7H5IN4S3/c1-13-6-11-12-7(15-6)14-5-4(8)2-9-3-10-5/h2-3H,1H3 |
| InChIKey | WOEDQJWGUUMEAK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|