About 5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]oxolane-2-carbohydrazide
5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]oxolane-2-carbohydrazide (PubChem CID 115383809) has the molecular formula C9H14N4O2S3
and a molecular weight of 306.44 g/mol. Its IUPAC name is 5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]oxolane-2-carbohydrazide.
Molecular Properties
| Compound Name | 5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]oxolane-2-carbohydrazide |
| PubChem CID | 115383809 |
| Molecular Formula | C9H14N4O2S3 |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]oxolane-2-carbohydrazide |
| SMILES | CSc1nnc(SCC2CCC(C(=O)NN)O2)s1 |
| InChI | InChI=1S/C9H14N4O2S3/c1-16-8-12-13-9(18-8)17-4-5-2-3-6(15-5)7(14)11-10/h5-6H,2-4,10H2,1H3,(H,11,14) |
| InChIKey | CHVMHPWGJHEDBZ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]oxolane-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]oxolane-2-carbohydrazide?
The IUPAC name of 5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]oxolane-2-carbohydrazide (CID 115383809) is 5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]oxolane-2-carbohydrazide.
What is the SMILES notation for 5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]oxolane-2-carbohydrazide?
The canonical SMILES for 5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]oxolane-2-carbohydrazide is CSc1nnc(SCC2CCC(C(=O)NN)O2)s1.
What is the InChIKey of 5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]oxolane-2-carbohydrazide?
The InChIKey is CHVMHPWGJHEDBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4O2S3/c1-16-8-12-13-9(18-8)17-4-5-2-3-6(15-5)7(14)11-10/h5-6H,2-4,10H2,1H3,(H,11,14).
What are the key properties of 5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]oxolane-2-carbohydrazide?
5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]oxolane-2-carbohydrazide has a molecular weight of 306.44 g/mol, XLogP of 0.89, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]oxolane-2-carbohydrazide is sourced from PubChem (CID 115383809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).