About 4-(iodomethyl)-2,4-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine
4-(iodomethyl)-2,4-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine (PubChem CID 11538417) has the molecular formula C14H20INO2S
and a molecular weight of 393.29 g/mol. Its IUPAC name is 4-(iodomethyl)-2,4-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine.
Molecular Properties
| Compound Name | 4-(iodomethyl)-2,4-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine |
| PubChem CID | 11538417 |
| Molecular Formula | C14H20INO2S |
| Molecular Weight | 393.29 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | 4-(iodomethyl)-2,4-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(C)(CI)CC2C)cc1 |
| InChI | InChI=1S/C14H20INO2S/c1-11-4-6-13(7-5-11)19(17,18)16-10-14(3,9-15)8-12(16)2/h4-7,12H,8-10H2,1-3H3 |
| InChIKey | DVQUEMSTPQGJQE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.29 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-(iodomethyl)-2,4-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(iodomethyl)-2,4-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine?
The IUPAC name of 4-(iodomethyl)-2,4-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine (CID 11538417) is 4-(iodomethyl)-2,4-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine.
What is the SMILES notation for 4-(iodomethyl)-2,4-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine?
The canonical SMILES for 4-(iodomethyl)-2,4-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine is Cc1ccc(S(=O)(=O)N2CC(C)(CI)CC2C)cc1.
What is the InChIKey of 4-(iodomethyl)-2,4-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine?
The InChIKey is DVQUEMSTPQGJQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20INO2S/c1-11-4-6-13(7-5-11)19(17,18)16-10-14(3,9-15)8-12(16)2/h4-7,12H,8-10H2,1-3H3.
What are the key properties of 4-(iodomethyl)-2,4-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine?
4-(iodomethyl)-2,4-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine has a molecular weight of 393.29 g/mol, XLogP of 3.22, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(iodomethyl)-2,4-dimethyl-1-(4-methylphenyl)sulfonylpyrrolidine is sourced from PubChem (CID 11538417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).