C12H14N4O2S3 — CID 115384361
3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-nitro-N-propylaniline (PubChem CID 115384361) has the molecular formula C12H14N4O2S3 and a molecular weight of 342.47 g/mol. Its IUPAC name is 3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-nitro-N-propylaniline.
| Compound Name | 3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-nitro-N-propylaniline |
|---|---|
| PubChem CID | 115384361 |
| Molecular Formula | C12H14N4O2S3 |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-nitro-N-propylaniline |
| SMILES | CCCNc1cccc(Sc2nnc(SC)s2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14N4O2S3/c1-3-7-13-8-5-4-6-9(10(8)16(17)18)20-12-15-14-11(19-2)21-12/h4-6,13H,3,7H2,1-2H3 |
| InChIKey | YYNBCAJPSXFGMM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|