C15H19N3OS2 — CID 115385301
4-[3-(3-ethyl-1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]-3-methylaniline (PubChem CID 115385301) has the molecular formula C15H19N3OS2 and a molecular weight of 321.47 g/mol. Its IUPAC name is 4-[3-(3-ethyl-1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]-3-methylaniline.
| Compound Name | 4-[3-(3-ethyl-1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]-3-methylaniline |
|---|---|
| PubChem CID | 115385301 |
| Molecular Formula | C15H19N3OS2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 4-[3-(3-ethyl-1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]-3-methylaniline |
| SMILES | CCC1SCCSC1c1noc(-c2ccc(N)cc2C)n1 |
| InChI | InChI=1S/C15H19N3OS2/c1-3-12-13(21-7-6-20-12)14-17-15(19-18-14)11-5-4-10(16)8-9(11)2/h4-5,8,12-13H,3,6-7,16H2,1-2H3 |
| InChIKey | ACFKRTDCZCLNBJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|