C13H23N3O2S2 — CID 115385316
1-[3-(3-ethyl-1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]-4-methoxybutan-1-amine (PubChem CID 115385316) has the molecular formula C13H23N3O2S2 and a molecular weight of 317.48 g/mol. Its IUPAC name is 1-[3-(3-ethyl-1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]-4-methoxybutan-1-amine.
| Compound Name | 1-[3-(3-ethyl-1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]-4-methoxybutan-1-amine |
|---|---|
| PubChem CID | 115385316 |
| Molecular Formula | C13H23N3O2S2 |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 1-[3-(3-ethyl-1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]-4-methoxybutan-1-amine |
| SMILES | CCC1SCCSC1c1noc(C(N)CCCOC)n1 |
| InChI | InChI=1S/C13H23N3O2S2/c1-3-10-11(20-8-7-19-10)12-15-13(18-16-12)9(14)5-4-6-17-2/h9-11H,3-8,14H2,1-2H3 |
| InChIKey | BMVSMJNEHTVTCO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|