C20H23N5O2S — CID 11538534
6-ethyl-5-[4-[(4-methylsulfonylanilino)methyl]phenyl]pyrimidine-2,4-diamine (PubChem CID 11538534) has the molecular formula C20H23N5O2S and a molecular weight of 397.50 g/mol. Its IUPAC name is 6-ethyl-5-[4-[(4-methylsulfonylanilino)methyl]phenyl]pyrimidine-2,4-diamine.
| Compound Name | 6-ethyl-5-[4-[(4-methylsulfonylanilino)methyl]phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 11538534 |
| Molecular Formula | C20H23N5O2S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 6-ethyl-5-[4-[(4-methylsulfonylanilino)methyl]phenyl]pyrimidine-2,4-diamine |
| SMILES | CCc1nc(N)nc(N)c1-c1ccc(CNc2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C20H23N5O2S/c1-3-17-18(19(21)25-20(22)24-17)14-6-4-13(5-7-14)12-23-15-8-10-16(11-9-15)28(2,26)27/h4-11,23H,3,12H2,1-2H3,(H4,21,22,24,25) |
| InChIKey | NREVZZLRLIFPFR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |