C8H13N3S3 — CID 115385468
3-(3-ethyl-1,4-dithian-2-yl)-1,2,4-thiadiazol-5-amine (PubChem CID 115385468) has the molecular formula C8H13N3S3 and a molecular weight of 247.41 g/mol. Its IUPAC name is 3-(3-ethyl-1,4-dithian-2-yl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-(3-ethyl-1,4-dithian-2-yl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 115385468 |
| Molecular Formula | C8H13N3S3 |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | 3-(3-ethyl-1,4-dithian-2-yl)-1,2,4-thiadiazol-5-amine |
| SMILES | CCC1SCCSC1c1nsc(N)n1 |
| InChI | InChI=1S/C8H13N3S3/c1-2-5-6(13-4-3-12-5)7-10-8(9)14-11-7/h5-6H,2-4H2,1H3,(H2,9,10,11) |
| InChIKey | RZQKGRWQBUBUPP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |