C22H26N2O3S — CID 11538551
1,1-dioxo-5-phenyl-4-(4-phenylbutylamino)-2-propan-2-yl-1,2-thiazol-3-one (PubChem CID 11538551) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is 1,1-dioxo-5-phenyl-4-(4-phenylbutylamino)-2-propan-2-yl-1,2-thiazol-3-one.
| Compound Name | 1,1-dioxo-5-phenyl-4-(4-phenylbutylamino)-2-propan-2-yl-1,2-thiazol-3-one |
|---|---|
| PubChem CID | 11538551 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 1,1-dioxo-5-phenyl-4-(4-phenylbutylamino)-2-propan-2-yl-1,2-thiazol-3-one |
| SMILES | CC(C)N1C(=O)C(NCCCCc2ccccc2)=C(c2ccccc2)S1(=O)=O |
| InChI | InChI=1S/C22H26N2O3S/c1-17(2)24-22(25)20(21(28(24,26)27)19-14-7-4-8-15-19)23-16-10-9-13-18-11-5-3-6-12-18/h3-8,11-12,14-15,17,23H,9-10,13,16H2,1-2H3 |
| InChIKey | NTLOUTBPNGQZRS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|