C9H10BrClN2S2 — CID 115385596
5-bromo-4-chloro-2-(3-methyl-1,4-dithian-2-yl)pyrimidine (PubChem CID 115385596) has the molecular formula C9H10BrClN2S2 and a molecular weight of 325.68 g/mol. Its IUPAC name is 5-bromo-4-chloro-2-(3-methyl-1,4-dithian-2-yl)pyrimidine.
| Compound Name | 5-bromo-4-chloro-2-(3-methyl-1,4-dithian-2-yl)pyrimidine |
|---|---|
| PubChem CID | 115385596 |
| Molecular Formula | C9H10BrClN2S2 |
| Molecular Weight | 325.68 g/mol |
| Exact Mass | 323.92 |
| IUPAC Name | 5-bromo-4-chloro-2-(3-methyl-1,4-dithian-2-yl)pyrimidine |
| SMILES | CC1SCCSC1c1ncc(Br)c(Cl)n1 |
| InChI | InChI=1S/C9H10BrClN2S2/c1-5-7(15-3-2-14-5)9-12-4-6(10)8(11)13-9/h4-5,7H,2-3H2,1H3 |
| InChIKey | BQAXYBIFOUHGDM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.68 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |