C14H20ClIN2S2 — CID 115385602
4-chloro-2-(3-ethyl-1,4-dithian-2-yl)-5-iodo-6-(2-methylpropyl)pyrimidine (PubChem CID 115385602) has the molecular formula C14H20ClIN2S2 and a molecular weight of 442.82 g/mol. Its IUPAC name is 4-chloro-2-(3-ethyl-1,4-dithian-2-yl)-5-iodo-6-(2-methylpropyl)pyrimidine.
| Compound Name | 4-chloro-2-(3-ethyl-1,4-dithian-2-yl)-5-iodo-6-(2-methylpropyl)pyrimidine |
|---|---|
| PubChem CID | 115385602 |
| Molecular Formula | C14H20ClIN2S2 |
| Molecular Weight | 442.82 g/mol |
| Exact Mass | 441.98 |
| IUPAC Name | 4-chloro-2-(3-ethyl-1,4-dithian-2-yl)-5-iodo-6-(2-methylpropyl)pyrimidine |
| SMILES | CCC1SCCSC1c1nc(Cl)c(I)c(CC(C)C)n1 |
| InChI | InChI=1S/C14H20ClIN2S2/c1-4-10-12(20-6-5-19-10)14-17-9(7-8(2)3)11(16)13(15)18-14/h8,10,12H,4-7H2,1-3H3 |
| InChIKey | UDGSJKHCTKRMQI-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.82 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|