C13H18N2OS2 — CID 115385851
2-(4-amino-3-pyridinyl)-1-(3-ethyl-1,4-dithian-2-yl)ethanone (PubChem CID 115385851) has the molecular formula C13H18N2OS2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 2-(4-amino-3-pyridinyl)-1-(3-ethyl-1,4-dithian-2-yl)ethanone.
| Compound Name | 2-(4-amino-3-pyridinyl)-1-(3-ethyl-1,4-dithian-2-yl)ethanone |
|---|---|
| PubChem CID | 115385851 |
| Molecular Formula | C13H18N2OS2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 2-(4-amino-3-pyridinyl)-1-(3-ethyl-1,4-dithian-2-yl)ethanone |
| SMILES | CCC1SCCSC1C(=O)Cc1cnccc1N |
| InChI | InChI=1S/C13H18N2OS2/c1-2-12-13(18-6-5-17-12)11(16)7-9-8-15-4-3-10(9)14/h3-4,8,12-13H,2,5-7H2,1H3,(H2,14,15) |
| InChIKey | RFZXYOXAOWTJTQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |