C9H16OS2 — CID 115386271
1-(3-methyl-1,4-dithian-2-yl)but-3-en-1-ol (PubChem CID 115386271) has the molecular formula C9H16OS2 and a molecular weight of 204.36 g/mol. Its IUPAC name is 1-(3-methyl-1,4-dithian-2-yl)but-3-en-1-ol.
| Compound Name | 1-(3-methyl-1,4-dithian-2-yl)but-3-en-1-ol |
|---|---|
| PubChem CID | 115386271 |
| Molecular Formula | C9H16OS2 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 1-(3-methyl-1,4-dithian-2-yl)but-3-en-1-ol |
| SMILES | C=CCC(O)C1SCCSC1C |
| InChI | InChI=1S/C9H16OS2/c1-3-4-8(10)9-7(2)11-5-6-12-9/h3,7-10H,1,4-6H2,2H3 |
| InChIKey | VFCYXJMHPLZQKL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|