C21H25NO7 — CID 11538653
2-[3-[5-(6-methoxynaphthalen-1-yl)-1,3-dioxan-2-yl]propylcarbamoyloxy]acetic acid (PubChem CID 11538653) has the molecular formula C21H25NO7 and a molecular weight of 403.43 g/mol. Its IUPAC name is 2-[3-[5-(6-methoxynaphthalen-1-yl)-1,3-dioxan-2-yl]propylcarbamoyloxy]acetic acid.
| Compound Name | 2-[3-[5-(6-methoxynaphthalen-1-yl)-1,3-dioxan-2-yl]propylcarbamoyloxy]acetic acid |
|---|---|
| PubChem CID | 11538653 |
| Molecular Formula | C21H25NO7 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 2-[3-[5-(6-methoxynaphthalen-1-yl)-1,3-dioxan-2-yl]propylcarbamoyloxy]acetic acid |
| SMILES | COc1ccc2c(C3COC(CCCNC(=O)OCC(=O)O)OC3)cccc2c1 |
| InChI | InChI=1S/C21H25NO7/c1-26-16-7-8-18-14(10-16)4-2-5-17(18)15-11-27-20(28-12-15)6-3-9-22-21(25)29-13-19(23)24/h2,4-5,7-8,10,15,20H,3,6,9,11-13H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | MDNAKOIYLYRLKZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|