C23H18FN3OS — CID 11538657
15-fluoro-4-(3-phenylpropylamino)-5-thia-3,10-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),3,7(12),8,14,16-heptaen-11-one (PubChem CID 11538657) has the molecular formula C23H18FN3OS and a molecular weight of 403.48 g/mol. Its IUPAC name is 15-fluoro-4-(3-phenylpropylamino)-5-thia-3,10-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),3,7(12),8,14,16-heptaen-11-one.
| Compound Name | 15-fluoro-4-(3-phenylpropylamino)-5-thia-3,10-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),3,7(12),8,14,16-heptaen-11-one |
|---|---|
| PubChem CID | 11538657 |
| Molecular Formula | C23H18FN3OS |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 15-fluoro-4-(3-phenylpropylamino)-5-thia-3,10-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),3,7(12),8,14,16-heptaen-11-one |
| SMILES | O=c1[nH]ccc2c3sc(NCCCc4ccccc4)nc3c3ccc(F)cc3c12 |
| InChI | InChI=1S/C23H18FN3OS/c24-15-8-9-16-18(13-15)19-17(10-12-25-22(19)28)21-20(16)27-23(29-21)26-11-4-7-14-5-2-1-3-6-14/h1-3,5-6,8-10,12-13H,4,7,11H2,(H,25,28)(H,26,27) |
| InChIKey | OXXJZDAFHZCLMU-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|