C13H25NS2 — CID 115387324
3-methyl-1-(3-methyl-1,4-dithian-2-yl)-N-propylbut-2-en-1-amine (PubChem CID 115387324) has the molecular formula C13H25NS2 and a molecular weight of 259.48 g/mol. Its IUPAC name is 3-methyl-1-(3-methyl-1,4-dithian-2-yl)-N-propylbut-2-en-1-amine.
| Compound Name | 3-methyl-1-(3-methyl-1,4-dithian-2-yl)-N-propylbut-2-en-1-amine |
|---|---|
| PubChem CID | 115387324 |
| Molecular Formula | C13H25NS2 |
| Molecular Weight | 259.48 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 3-methyl-1-(3-methyl-1,4-dithian-2-yl)-N-propylbut-2-en-1-amine |
| SMILES | CCCNC(C=C(C)C)C1SCCSC1C |
| InChI | InChI=1S/C13H25NS2/c1-5-6-14-12(9-10(2)3)13-11(4)15-7-8-16-13/h9,11-14H,5-8H2,1-4H3 |
| InChIKey | AEFCHVRTOVQQAL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|