C13H17ClFNS2 — CID 115387570
(4-chloro-2-fluorophenyl)-(3-ethyl-1,4-dithian-2-yl)methanamine (PubChem CID 115387570) has the molecular formula C13H17ClFNS2 and a molecular weight of 305.87 g/mol. Its IUPAC name is (4-chloro-2-fluorophenyl)-(3-ethyl-1,4-dithian-2-yl)methanamine.
| Compound Name | (4-chloro-2-fluorophenyl)-(3-ethyl-1,4-dithian-2-yl)methanamine |
|---|---|
| PubChem CID | 115387570 |
| Molecular Formula | C13H17ClFNS2 |
| Molecular Weight | 305.87 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | (4-chloro-2-fluorophenyl)-(3-ethyl-1,4-dithian-2-yl)methanamine |
| SMILES | CCC1SCCSC1C(N)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C13H17ClFNS2/c1-2-11-13(18-6-5-17-11)12(16)9-4-3-8(14)7-10(9)15/h3-4,7,11-13H,2,5-6,16H2,1H3 |
| InChIKey | LZGBWYOPGDVOTA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.87 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |