C15H12Cl2N4O4S — CID 11538908
8-amino-1,10-dichloro-N-(diaminomethylidene)-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide (PubChem CID 11538908) has the molecular formula C15H12Cl2N4O4S and a molecular weight of 415.26 g/mol. Its IUPAC name is 8-amino-1,10-dichloro-N-(diaminomethylidene)-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide.
| Compound Name | 8-amino-1,10-dichloro-N-(diaminomethylidene)-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide |
|---|---|
| PubChem CID | 11538908 |
| Molecular Formula | C15H12Cl2N4O4S |
| Molecular Weight | 415.26 g/mol |
| Exact Mass | 414.00 |
| IUPAC Name | 8-amino-1,10-dichloro-N-(diaminomethylidene)-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide |
| SMILES | NC(N)=NC(=O)c1cc(Cl)c2c(c1)S(=O)(=O)Cc1cc(N)cc(Cl)c1O2 |
| InChI | InChI=1S/C15H12Cl2N4O4S/c16-9-2-6(14(22)21-15(19)20)3-11-13(9)25-12-7(5-26(11,23)24)1-8(18)4-10(12)17/h1-4H,5,18H2,(H4,19,20,21,22) |
| InChIKey | STOMUECMNOJEBH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 150.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|