C16H32N2S — CID 115389298
2-methyl-N-(2,4,4-trimethylpentan-2-yl)azepane-1-carbothioamide (PubChem CID 115389298) has the molecular formula C16H32N2S and a molecular weight of 284.51 g/mol. Its IUPAC name is 2-methyl-N-(2,4,4-trimethylpentan-2-yl)azepane-1-carbothioamide.
| Compound Name | 2-methyl-N-(2,4,4-trimethylpentan-2-yl)azepane-1-carbothioamide |
|---|---|
| PubChem CID | 115389298 |
| Molecular Formula | C16H32N2S |
| Molecular Weight | 284.51 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | 2-methyl-N-(2,4,4-trimethylpentan-2-yl)azepane-1-carbothioamide |
| SMILES | CC1CCCCCN1C(=S)NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C16H32N2S/c1-13-10-8-7-9-11-18(13)14(19)17-16(5,6)12-15(2,3)4/h13H,7-12H2,1-6H3,(H,17,19) |
| InChIKey | IUDZUOKLAZMBHW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|