C7H11N3O2S — CID 115389370
3-(1,4-dioxan-2-yl)-4-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 115389370) has the molecular formula C7H11N3O2S and a molecular weight of 201.25 g/mol. Its IUPAC name is 3-(1,4-dioxan-2-yl)-4-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(1,4-dioxan-2-yl)-4-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 115389370 |
| Molecular Formula | C7H11N3O2S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 3-(1,4-dioxan-2-yl)-4-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | Cn1c(C2COCCO2)n[nH]c1=S |
| InChI | InChI=1S/C7H11N3O2S/c1-10-6(8-9-7(10)13)5-4-11-2-3-12-5/h5H,2-4H2,1H3,(H,9,13) |
| InChIKey | HXQDCRJNVYYXAH-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 52.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|