C11H14N4S — CID 115389734
4-propyl-3-(pyridin-3-ylmethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 115389734) has the molecular formula C11H14N4S and a molecular weight of 234.33 g/mol. Its IUPAC name is 4-propyl-3-(pyridin-3-ylmethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-propyl-3-(pyridin-3-ylmethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 115389734 |
| Molecular Formula | C11H14N4S |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 4-propyl-3-(pyridin-3-ylmethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCCn1c(Cc2cccnc2)n[nH]c1=S |
| InChI | InChI=1S/C11H14N4S/c1-2-6-15-10(13-14-11(15)16)7-9-4-3-5-12-8-9/h3-5,8H,2,6-7H2,1H3,(H,14,16) |
| InChIKey | PMRTXFGWFBKIJT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|