C12H21N3OS — CID 115391071
4-(2-methoxyethyl)-3-(2,2,3,3-tetramethylcyclopropyl)-1H-1,2,4-triazole-5-thione (PubChem CID 115391071) has the molecular formula C12H21N3OS and a molecular weight of 255.39 g/mol. Its IUPAC name is 4-(2-methoxyethyl)-3-(2,2,3,3-tetramethylcyclopropyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(2-methoxyethyl)-3-(2,2,3,3-tetramethylcyclopropyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 115391071 |
| Molecular Formula | C12H21N3OS |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 4-(2-methoxyethyl)-3-(2,2,3,3-tetramethylcyclopropyl)-1H-1,2,4-triazole-5-thione |
| SMILES | COCCn1c(C2C(C)(C)C2(C)C)n[nH]c1=S |
| InChI | InChI=1S/C12H21N3OS/c1-11(2)8(12(11,3)4)9-13-14-10(17)15(9)6-7-16-5/h8H,6-7H2,1-5H3,(H,14,17) |
| InChIKey | VZOXLAWQMQBLBS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|