C21H23N5O5 — CID 11539128
N-[[2-[2-[(2R)-2-methylpyrrolidin-1-yl]ethyl]-1-benzofuran-5-yl]methyl]-3,5-dinitropyridin-2-amine (PubChem CID 11539128) has the molecular formula C21H23N5O5 and a molecular weight of 425.45 g/mol. Its IUPAC name is N-[[2-[2-[(2R)-2-methylpyrrolidin-1-yl]ethyl]-1-benzofuran-5-yl]methyl]-3,5-dinitropyridin-2-amine.
| Compound Name | N-[[2-[2-[(2R)-2-methylpyrrolidin-1-yl]ethyl]-1-benzofuran-5-yl]methyl]-3,5-dinitropyridin-2-amine |
|---|---|
| PubChem CID | 11539128 |
| Molecular Formula | C21H23N5O5 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | N-[[2-[2-[(2R)-2-methylpyrrolidin-1-yl]ethyl]-1-benzofuran-5-yl]methyl]-3,5-dinitropyridin-2-amine |
| SMILES | C[C@@H]1CCCN1CCc1cc2cc(CNc3ncc([N+](=O)[O-])cc3[N+](=O)[O-])ccc2o1 |
| InChI | InChI=1S/C21H23N5O5/c1-14-3-2-7-24(14)8-6-18-10-16-9-15(4-5-20(16)31-18)12-22-21-19(26(29)30)11-17(13-23-21)25(27)28/h4-5,9-11,13-14H,2-3,6-8,12H2,1H3,(H,22,23)/t14-/m1/s1 |
| InChIKey | XUJDKFIEXNZSEL-CQSZACIVSA-N |
| XLogP | 4.28 |
| TPSA | 127.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|