C16H13N3OS — CID 115391479
3-(1,3-dihydro-2-benzofuran-5-yl)-4-phenyl-1H-1,2,4-triazole-5-thione (PubChem CID 115391479) has the molecular formula C16H13N3OS and a molecular weight of 295.37 g/mol. Its IUPAC name is 3-(1,3-dihydro-2-benzofuran-5-yl)-4-phenyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(1,3-dihydro-2-benzofuran-5-yl)-4-phenyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 115391479 |
| Molecular Formula | C16H13N3OS |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 3-(1,3-dihydro-2-benzofuran-5-yl)-4-phenyl-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(-c2ccc3c(c2)COC3)n1-c1ccccc1 |
| InChI | InChI=1S/C16H13N3OS/c21-16-18-17-15(19(16)14-4-2-1-3-5-14)11-6-7-12-9-20-10-13(12)8-11/h1-8H,9-10H2,(H,18,21) |
| InChIKey | QGBYUSCFLNNSFI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|