C14H15N3O2S — CID 115391713
2-[(5-cyclobutyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid (PubChem CID 115391713) has the molecular formula C14H15N3O2S and a molecular weight of 289.36 g/mol. Its IUPAC name is 2-[(5-cyclobutyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid.
| Compound Name | 2-[(5-cyclobutyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid |
|---|---|
| PubChem CID | 115391713 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 2-[(5-cyclobutyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid |
| SMILES | O=C(O)CSc1nnc(C2CCC2)n1-c1ccccc1 |
| InChI | InChI=1S/C14H15N3O2S/c18-12(19)9-20-14-16-15-13(10-5-4-6-10)17(14)11-7-2-1-3-8-11/h1-3,7-8,10H,4-6,9H2,(H,18,19) |
| InChIKey | LEZWXAJNNSMHRX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |