About 8-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoro-9-pent-4-ynylpurin-6-amine
8-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoro-9-pent-4-ynylpurin-6-amine (PubChem CID 11539274) has the molecular formula C18H15BrFN5O2
and a molecular weight of 432.25 g/mol. Its IUPAC name is 8-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoro-9-pent-4-ynylpurin-6-amine.
Molecular Properties
| Compound Name | 8-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoro-9-pent-4-ynylpurin-6-amine |
| PubChem CID | 11539274 |
| Molecular Formula | C18H15BrFN5O2 |
| Molecular Weight | 432.25 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | 8-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoro-9-pent-4-ynylpurin-6-amine |
| SMILES | C#CCCCn1c(Cc2cc3c(cc2Br)OCO3)nc2c(N)nc(F)nc21 |
| InChI | InChI=1S/C18H15BrFN5O2/c1-2-3-4-5-25-14(22-15-16(21)23-18(20)24-17(15)25)7-10-6-12-13(8-11(10)19)27-9-26-12/h1,6,8H,3-5,7,9H2,(H2,21,23,24) |
| InChIKey | QGPOJWKORWNCCI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.25 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoro-9-pent-4-ynylpurin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoro-9-pent-4-ynylpurin-6-amine?
The IUPAC name of 8-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoro-9-pent-4-ynylpurin-6-amine (CID 11539274) is 8-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoro-9-pent-4-ynylpurin-6-amine.
What is the SMILES notation for 8-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoro-9-pent-4-ynylpurin-6-amine?
The canonical SMILES for 8-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoro-9-pent-4-ynylpurin-6-amine is C#CCCCn1c(Cc2cc3c(cc2Br)OCO3)nc2c(N)nc(F)nc21.
What is the InChIKey of 8-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoro-9-pent-4-ynylpurin-6-amine?
The InChIKey is QGPOJWKORWNCCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15BrFN5O2/c1-2-3-4-5-25-14(22-15-16(21)23-18(20)24-17(15)25)7-10-6-12-13(8-11(10)19)27-9-26-12/h1,6,8H,3-5,7,9H2,(H2,21,23,24).
What are the key properties of 8-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoro-9-pent-4-ynylpurin-6-amine?
8-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoro-9-pent-4-ynylpurin-6-amine has a molecular weight of 432.25 g/mol, XLogP of 3.04, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoro-9-pent-4-ynylpurin-6-amine is sourced from PubChem (CID 11539274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).