C9H15N3O3S — CID 115392944
2-[[5-(4-hydroxybutyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetic acid (PubChem CID 115392944) has the molecular formula C9H15N3O3S and a molecular weight of 245.30 g/mol. Its IUPAC name is 2-[[5-(4-hydroxybutyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-(4-hydroxybutyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 115392944 |
| Molecular Formula | C9H15N3O3S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 2-[[5-(4-hydroxybutyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| SMILES | Cn1c(CCCCO)nnc1SCC(=O)O |
| InChI | InChI=1S/C9H15N3O3S/c1-12-7(4-2-3-5-13)10-11-9(12)16-6-8(14)15/h13H,2-6H2,1H3,(H,14,15) |
| InChIKey | JPMOADQKIMFSOI-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|