About 3-[2-(oxolan-2-yl)ethyl]-4-phenyl-1,2,4-triazole
3-[2-(oxolan-2-yl)ethyl]-4-phenyl-1,2,4-triazole (PubChem CID 115393361) has the molecular formula C14H17N3O
and a molecular weight of 243.31 g/mol. Its IUPAC name is 3-[2-(oxolan-2-yl)ethyl]-4-phenyl-1,2,4-triazole.
Molecular Properties
| Compound Name | 3-[2-(oxolan-2-yl)ethyl]-4-phenyl-1,2,4-triazole |
| PubChem CID | 115393361 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 3-[2-(oxolan-2-yl)ethyl]-4-phenyl-1,2,4-triazole |
| SMILES | c1ccc(-n2cnnc2CCC2CCCO2)cc1 |
| InChI | InChI=1S/C14H17N3O/c1-2-5-12(6-3-1)17-11-15-16-14(17)9-8-13-7-4-10-18-13/h1-3,5-6,11,13H,4,7-10H2 |
| InChIKey | SVDZFAGYIZNYBS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2-(oxolan-2-yl)ethyl]-4-phenyl-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(oxolan-2-yl)ethyl]-4-phenyl-1,2,4-triazole?
The IUPAC name of 3-[2-(oxolan-2-yl)ethyl]-4-phenyl-1,2,4-triazole (CID 115393361) is 3-[2-(oxolan-2-yl)ethyl]-4-phenyl-1,2,4-triazole.
What is the SMILES notation for 3-[2-(oxolan-2-yl)ethyl]-4-phenyl-1,2,4-triazole?
The canonical SMILES for 3-[2-(oxolan-2-yl)ethyl]-4-phenyl-1,2,4-triazole is c1ccc(-n2cnnc2CCC2CCCO2)cc1.
What is the InChIKey of 3-[2-(oxolan-2-yl)ethyl]-4-phenyl-1,2,4-triazole?
The InChIKey is SVDZFAGYIZNYBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O/c1-2-5-12(6-3-1)17-11-15-16-14(17)9-8-13-7-4-10-18-13/h1-3,5-6,11,13H,4,7-10H2.
What are the key properties of 3-[2-(oxolan-2-yl)ethyl]-4-phenyl-1,2,4-triazole?
3-[2-(oxolan-2-yl)ethyl]-4-phenyl-1,2,4-triazole has a molecular weight of 243.31 g/mol, XLogP of 2.38, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(oxolan-2-yl)ethyl]-4-phenyl-1,2,4-triazole is sourced from PubChem (CID 115393361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).