C16H21N3 — CID 115393404
3-(2-cyclohexylethyl)-4-phenyl-1,2,4-triazole (PubChem CID 115393404) has the molecular formula C16H21N3 and a molecular weight of 255.37 g/mol. Its IUPAC name is 3-(2-cyclohexylethyl)-4-phenyl-1,2,4-triazole.
| Compound Name | 3-(2-cyclohexylethyl)-4-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 115393404 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 3-(2-cyclohexylethyl)-4-phenyl-1,2,4-triazole |
| SMILES | c1ccc(-n2cnnc2CCC2CCCCC2)cc1 |
| InChI | InChI=1S/C16H21N3/c1-3-7-14(8-4-1)11-12-16-18-17-13-19(16)15-9-5-2-6-10-15/h2,5-6,9-10,13-14H,1,3-4,7-8,11-12H2 |
| InChIKey | GAFBWHFGMGHMJE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |