About 5-(4-ethyl-1,2,4-triazol-3-yl)-4-methyl-1,3-thiazole
5-(4-ethyl-1,2,4-triazol-3-yl)-4-methyl-1,3-thiazole (PubChem CID 115394795) has the molecular formula C8H10N4S
and a molecular weight of 194.26 g/mol. Its IUPAC name is 5-(4-ethyl-1,2,4-triazol-3-yl)-4-methyl-1,3-thiazole.
Analyze 5-(4-ethyl-1,2,4-triazol-3-yl)-4-methyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-ethyl-1,2,4-triazol-3-yl)-4-methyl-1,3-thiazole?
The IUPAC name of 5-(4-ethyl-1,2,4-triazol-3-yl)-4-methyl-1,3-thiazole (CID 115394795) is 5-(4-ethyl-1,2,4-triazol-3-yl)-4-methyl-1,3-thiazole.
What is the SMILES notation for 5-(4-ethyl-1,2,4-triazol-3-yl)-4-methyl-1,3-thiazole?
The canonical SMILES for 5-(4-ethyl-1,2,4-triazol-3-yl)-4-methyl-1,3-thiazole is CCn1cnnc1-c1scnc1C.
What is the InChIKey of 5-(4-ethyl-1,2,4-triazol-3-yl)-4-methyl-1,3-thiazole?
The InChIKey is HAXRERFYKOGSID-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4S/c1-3-12-4-10-11-8(12)7-6(2)9-5-13-7/h4-5H,3H2,1-2H3.
What are the key properties of 5-(4-ethyl-1,2,4-triazol-3-yl)-4-methyl-1,3-thiazole?
5-(4-ethyl-1,2,4-triazol-3-yl)-4-methyl-1,3-thiazole has a molecular weight of 194.26 g/mol, XLogP of 1.73, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-ethyl-1,2,4-triazol-3-yl)-4-methyl-1,3-thiazole is sourced from PubChem (CID 115394795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).