About 5-(4-ethyl-1,2,4-triazol-3-yl)-4-methyl-1,3-thiazole
5-(4-ethyl-1,2,4-triazol-3-yl)-4-methyl-1,3-thiazole (PubChem CID 115394795) has the molecular formula C8H10N4S
and a molecular weight of 194.26 g/mol. Its IUPAC name is 5-(4-ethyl-1,2,4-triazol-3-yl)-4-methyl-1,3-thiazole.
Molecular Properties
| Compound Name | 5-(4-ethyl-1,2,4-triazol-3-yl)-4-methyl-1,3-thiazole |
| PubChem CID | 115394795 |
| Molecular Formula | C8H10N4S |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 5-(4-ethyl-1,2,4-triazol-3-yl)-4-methyl-1,3-thiazole |
| SMILES | CCn1cnnc1-c1scnc1C |
| InChI | InChI=1S/C8H10N4S/c1-3-12-4-10-11-8(12)7-6(2)9-5-13-7/h4-5H,3H2,1-2H3 |
| InChIKey | HAXRERFYKOGSID-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(4-ethyl-1,2,4-triazol-3-yl)-4-methyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-ethyl-1,2,4-triazol-3-yl)-4-methyl-1,3-thiazole?
The IUPAC name of 5-(4-ethyl-1,2,4-triazol-3-yl)-4-methyl-1,3-thiazole (CID 115394795) is 5-(4-ethyl-1,2,4-triazol-3-yl)-4-methyl-1,3-thiazole.
What is the SMILES notation for 5-(4-ethyl-1,2,4-triazol-3-yl)-4-methyl-1,3-thiazole?
The canonical SMILES for 5-(4-ethyl-1,2,4-triazol-3-yl)-4-methyl-1,3-thiazole is CCn1cnnc1-c1scnc1C.
What is the InChIKey of 5-(4-ethyl-1,2,4-triazol-3-yl)-4-methyl-1,3-thiazole?
The InChIKey is HAXRERFYKOGSID-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4S/c1-3-12-4-10-11-8(12)7-6(2)9-5-13-7/h4-5H,3H2,1-2H3.
What are the key properties of 5-(4-ethyl-1,2,4-triazol-3-yl)-4-methyl-1,3-thiazole?
5-(4-ethyl-1,2,4-triazol-3-yl)-4-methyl-1,3-thiazole has a molecular weight of 194.26 g/mol, XLogP of 1.73, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-ethyl-1,2,4-triazol-3-yl)-4-methyl-1,3-thiazole is sourced from PubChem (CID 115394795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).