C10H17N3 — CID 115395675
3-cyclobutyl-4-(2-methylpropyl)-1,2,4-triazole (PubChem CID 115395675) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 3-cyclobutyl-4-(2-methylpropyl)-1,2,4-triazole.
| Compound Name | 3-cyclobutyl-4-(2-methylpropyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 115395675 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 3-cyclobutyl-4-(2-methylpropyl)-1,2,4-triazole |
| SMILES | CC(C)Cn1cnnc1C1CCC1 |
| InChI | InChI=1S/C10H17N3/c1-8(2)6-13-7-11-12-10(13)9-4-3-5-9/h7-9H,3-6H2,1-2H3 |
| InChIKey | JPBFBNBSMMLOJD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |