C23H25Cl2N3O2 — CID 11539587
3-(2,6-dichlorophenyl)-N-[4-(diethylamino)phenyl]-5-propyl-1,2-oxazole-4-carboxamide (PubChem CID 11539587) has the molecular formula C23H25Cl2N3O2 and a molecular weight of 446.38 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-N-[4-(diethylamino)phenyl]-5-propyl-1,2-oxazole-4-carboxamide.
| Compound Name | 3-(2,6-dichlorophenyl)-N-[4-(diethylamino)phenyl]-5-propyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 11539587 |
| Molecular Formula | C23H25Cl2N3O2 |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-N-[4-(diethylamino)phenyl]-5-propyl-1,2-oxazole-4-carboxamide |
| SMILES | CCCc1onc(-c2c(Cl)cccc2Cl)c1C(=O)Nc1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C23H25Cl2N3O2/c1-4-8-19-21(22(27-30-19)20-17(24)9-7-10-18(20)25)23(29)26-15-11-13-16(14-12-15)28(5-2)6-3/h7,9-14H,4-6,8H2,1-3H3,(H,26,29) |
| InChIKey | LEMXNVRNBKBRBC-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|