About 3-(2,6-dichlorophenyl)-N-[4-(diethylamino)phenyl]-5-propan-2-yl-1,2-oxazole-4-carboxamide
3-(2,6-dichlorophenyl)-N-[4-(diethylamino)phenyl]-5-propan-2-yl-1,2-oxazole-4-carboxamide (PubChem CID 11539588) has the molecular formula C23H25Cl2N3O2
and a molecular weight of 446.38 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-N-[4-(diethylamino)phenyl]-5-propan-2-yl-1,2-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 3-(2,6-dichlorophenyl)-N-[4-(diethylamino)phenyl]-5-propan-2-yl-1,2-oxazole-4-carboxamide |
| PubChem CID | 11539588 |
| Molecular Formula | C23H25Cl2N3O2 |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-N-[4-(diethylamino)phenyl]-5-propan-2-yl-1,2-oxazole-4-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2c(-c3c(Cl)cccc3Cl)noc2C(C)C)cc1 |
| InChI | InChI=1S/C23H25Cl2N3O2/c1-5-28(6-2)16-12-10-15(11-13-16)26-23(29)20-21(27-30-22(20)14(3)4)19-17(24)8-7-9-18(19)25/h7-14H,5-6H2,1-4H3,(H,26,29) |
| InChIKey | FSXIPPGSTKLDSC-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,6-dichlorophenyl)-N-[4-(diethylamino)phenyl]-5-propan-2-yl-1,2-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,6-dichlorophenyl)-N-[4-(diethylamino)phenyl]-5-propan-2-yl-1,2-oxazole-4-carboxamide?
The IUPAC name of 3-(2,6-dichlorophenyl)-N-[4-(diethylamino)phenyl]-5-propan-2-yl-1,2-oxazole-4-carboxamide (CID 11539588) is 3-(2,6-dichlorophenyl)-N-[4-(diethylamino)phenyl]-5-propan-2-yl-1,2-oxazole-4-carboxamide.
What is the SMILES notation for 3-(2,6-dichlorophenyl)-N-[4-(diethylamino)phenyl]-5-propan-2-yl-1,2-oxazole-4-carboxamide?
The canonical SMILES for 3-(2,6-dichlorophenyl)-N-[4-(diethylamino)phenyl]-5-propan-2-yl-1,2-oxazole-4-carboxamide is CCN(CC)c1ccc(NC(=O)c2c(-c3c(Cl)cccc3Cl)noc2C(C)C)cc1.
What is the InChIKey of 3-(2,6-dichlorophenyl)-N-[4-(diethylamino)phenyl]-5-propan-2-yl-1,2-oxazole-4-carboxamide?
The InChIKey is FSXIPPGSTKLDSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25Cl2N3O2/c1-5-28(6-2)16-12-10-15(11-13-16)26-23(29)20-21(27-30-22(20)14(3)4)19-17(24)8-7-9-18(19)25/h7-14H,5-6H2,1-4H3,(H,26,29).
What are the key properties of 3-(2,6-dichlorophenyl)-N-[4-(diethylamino)phenyl]-5-propan-2-yl-1,2-oxazole-4-carboxamide?
3-(2,6-dichlorophenyl)-N-[4-(diethylamino)phenyl]-5-propan-2-yl-1,2-oxazole-4-carboxamide has a molecular weight of 446.38 g/mol, XLogP of 6.87, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-dichlorophenyl)-N-[4-(diethylamino)phenyl]-5-propan-2-yl-1,2-oxazole-4-carboxamide is sourced from PubChem (CID 11539588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).