C13H14N4O3 — CID 115396283
[4-cyclopropyl-5-(3-methyl-2-nitrophenyl)-1,2,4-triazol-3-yl]methanol (PubChem CID 115396283) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is [4-cyclopropyl-5-(3-methyl-2-nitrophenyl)-1,2,4-triazol-3-yl]methanol.
| Compound Name | [4-cyclopropyl-5-(3-methyl-2-nitrophenyl)-1,2,4-triazol-3-yl]methanol |
|---|---|
| PubChem CID | 115396283 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | [4-cyclopropyl-5-(3-methyl-2-nitrophenyl)-1,2,4-triazol-3-yl]methanol |
| SMILES | Cc1cccc(-c2nnc(CO)n2C2CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H14N4O3/c1-8-3-2-4-10(12(8)17(19)20)13-15-14-11(7-18)16(13)9-5-6-9/h2-4,9,18H,5-7H2,1H3 |
| InChIKey | WQAXZBZHNGIRBA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|