C12H21N3O — CID 115396998
(5-cyclooctyl-4-methyl-1,2,4-triazol-3-yl)methanol (PubChem CID 115396998) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is (5-cyclooctyl-4-methyl-1,2,4-triazol-3-yl)methanol.
| Compound Name | (5-cyclooctyl-4-methyl-1,2,4-triazol-3-yl)methanol |
|---|---|
| PubChem CID | 115396998 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | (5-cyclooctyl-4-methyl-1,2,4-triazol-3-yl)methanol |
| SMILES | Cn1c(CO)nnc1C1CCCCCCC1 |
| InChI | InChI=1S/C12H21N3O/c1-15-11(9-16)13-14-12(15)10-7-5-3-2-4-6-8-10/h10,16H,2-9H2,1H3 |
| InChIKey | CVAJLVWGOGVBPY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |