C24H40N2O4S — CID 11539723
(1R,3S)-1-(aminomethyl)-6-methyl-3-(1-octylsulfonylpiperidin-4-yl)-3,4-dihydro-1H-isochromen-5-ol (PubChem CID 11539723) has the molecular formula C24H40N2O4S and a molecular weight of 452.66 g/mol. Its IUPAC name is (1R,3S)-1-(aminomethyl)-6-methyl-3-(1-octylsulfonylpiperidin-4-yl)-3,4-dihydro-1H-isochromen-5-ol.
| Compound Name | (1R,3S)-1-(aminomethyl)-6-methyl-3-(1-octylsulfonylpiperidin-4-yl)-3,4-dihydro-1H-isochromen-5-ol |
|---|---|
| PubChem CID | 11539723 |
| Molecular Formula | C24H40N2O4S |
| Molecular Weight | 452.66 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | (1R,3S)-1-(aminomethyl)-6-methyl-3-(1-octylsulfonylpiperidin-4-yl)-3,4-dihydro-1H-isochromen-5-ol |
| SMILES | CCCCCCCCS(=O)(=O)N1CCC([C@@H]2Cc3c(ccc(C)c3O)[C@H](CN)O2)CC1 |
| InChI | InChI=1S/C24H40N2O4S/c1-3-4-5-6-7-8-15-31(28,29)26-13-11-19(12-14-26)22-16-21-20(23(17-25)30-22)10-9-18(2)24(21)27/h9-10,19,22-23,27H,3-8,11-17,25H2,1-2H3/t22-,23-/m0/s1 |
| InChIKey | SZESCBBOZOCCSP-GOTSBHOMSA-N |
| XLogP | 4.04 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.66 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|