C11H20ClN3O2 — CID 115397428
3-(chloromethyl)-4-(2-methoxyethyl)-5-(3-methoxy-2-methylpropyl)-1,2,4-triazole (PubChem CID 115397428) has the molecular formula C11H20ClN3O2 and a molecular weight of 261.75 g/mol. Its IUPAC name is 3-(chloromethyl)-4-(2-methoxyethyl)-5-(3-methoxy-2-methylpropyl)-1,2,4-triazole.
| Compound Name | 3-(chloromethyl)-4-(2-methoxyethyl)-5-(3-methoxy-2-methylpropyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 115397428 |
| Molecular Formula | C11H20ClN3O2 |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 3-(chloromethyl)-4-(2-methoxyethyl)-5-(3-methoxy-2-methylpropyl)-1,2,4-triazole |
| SMILES | COCCn1c(CCl)nnc1CC(C)COC |
| InChI | InChI=1S/C11H20ClN3O2/c1-9(8-17-3)6-10-13-14-11(7-12)15(10)4-5-16-2/h9H,4-8H2,1-3H3 |
| InChIKey | MGFUNUXDQLDOOZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|