C14H16ClF2N3 — CID 115398566
3-(chloromethyl)-5-[(3,4-difluorophenyl)methyl]-4-(2-methylpropyl)-1,2,4-triazole (PubChem CID 115398566) has the molecular formula C14H16ClF2N3 and a molecular weight of 299.75 g/mol. Its IUPAC name is 3-(chloromethyl)-5-[(3,4-difluorophenyl)methyl]-4-(2-methylpropyl)-1,2,4-triazole.
| Compound Name | 3-(chloromethyl)-5-[(3,4-difluorophenyl)methyl]-4-(2-methylpropyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 115398566 |
| Molecular Formula | C14H16ClF2N3 |
| Molecular Weight | 299.75 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 3-(chloromethyl)-5-[(3,4-difluorophenyl)methyl]-4-(2-methylpropyl)-1,2,4-triazole |
| SMILES | CC(C)Cn1c(CCl)nnc1Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H16ClF2N3/c1-9(2)8-20-13(18-19-14(20)7-15)6-10-3-4-11(16)12(17)5-10/h3-5,9H,6-8H2,1-2H3 |
| InChIKey | UAMBNJUGURXJNC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.75 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|