C15H20ClN3 — CID 115398690
3-(chloromethyl)-5-(3,5-dimethylphenyl)-4-(2-methylpropyl)-1,2,4-triazole (PubChem CID 115398690) has the molecular formula C15H20ClN3 and a molecular weight of 277.80 g/mol. Its IUPAC name is 3-(chloromethyl)-5-(3,5-dimethylphenyl)-4-(2-methylpropyl)-1,2,4-triazole.
| Compound Name | 3-(chloromethyl)-5-(3,5-dimethylphenyl)-4-(2-methylpropyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 115398690 |
| Molecular Formula | C15H20ClN3 |
| Molecular Weight | 277.80 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 3-(chloromethyl)-5-(3,5-dimethylphenyl)-4-(2-methylpropyl)-1,2,4-triazole |
| SMILES | Cc1cc(C)cc(-c2nnc(CCl)n2CC(C)C)c1 |
| InChI | InChI=1S/C15H20ClN3/c1-10(2)9-19-14(8-16)17-18-15(19)13-6-11(3)5-12(4)7-13/h5-7,10H,8-9H2,1-4H3 |
| InChIKey | HSGWDLYPNQFFHJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.80 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|