About 3-(bromomethyl)-4,5-di(propan-2-yl)-1,2,4-triazole
3-(bromomethyl)-4,5-di(propan-2-yl)-1,2,4-triazole (PubChem CID 115399043) has the molecular formula C9H16BrN3
and a molecular weight of 246.15 g/mol. Its IUPAC name is 3-(bromomethyl)-4,5-di(propan-2-yl)-1,2,4-triazole.
Molecular Properties
| Compound Name | 3-(bromomethyl)-4,5-di(propan-2-yl)-1,2,4-triazole |
| PubChem CID | 115399043 |
| Molecular Formula | C9H16BrN3 |
| Molecular Weight | 246.15 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 3-(bromomethyl)-4,5-di(propan-2-yl)-1,2,4-triazole |
| SMILES | CC(C)c1nnc(CBr)n1C(C)C |
| InChI | InChI=1S/C9H16BrN3/c1-6(2)9-12-11-8(5-10)13(9)7(3)4/h6-7H,5H2,1-4H3 |
| InChIKey | CPJMCVSWFRSOIX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.15 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(bromomethyl)-4,5-di(propan-2-yl)-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(bromomethyl)-4,5-di(propan-2-yl)-1,2,4-triazole?
The IUPAC name of 3-(bromomethyl)-4,5-di(propan-2-yl)-1,2,4-triazole (CID 115399043) is 3-(bromomethyl)-4,5-di(propan-2-yl)-1,2,4-triazole.
What is the SMILES notation for 3-(bromomethyl)-4,5-di(propan-2-yl)-1,2,4-triazole?
The canonical SMILES for 3-(bromomethyl)-4,5-di(propan-2-yl)-1,2,4-triazole is CC(C)c1nnc(CBr)n1C(C)C.
What is the InChIKey of 3-(bromomethyl)-4,5-di(propan-2-yl)-1,2,4-triazole?
The InChIKey is CPJMCVSWFRSOIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16BrN3/c1-6(2)9-12-11-8(5-10)13(9)7(3)4/h6-7H,5H2,1-4H3.
What are the key properties of 3-(bromomethyl)-4,5-di(propan-2-yl)-1,2,4-triazole?
3-(bromomethyl)-4,5-di(propan-2-yl)-1,2,4-triazole has a molecular weight of 246.15 g/mol, XLogP of 2.88, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(bromomethyl)-4,5-di(propan-2-yl)-1,2,4-triazole is sourced from PubChem (CID 115399043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).