C8H9BrF3N3 — CID 115399146
3-(bromomethyl)-4-cyclopropyl-5-(2,2,2-trifluoroethyl)-1,2,4-triazole (PubChem CID 115399146) has the molecular formula C8H9BrF3N3 and a molecular weight of 284.08 g/mol. Its IUPAC name is 3-(bromomethyl)-4-cyclopropyl-5-(2,2,2-trifluoroethyl)-1,2,4-triazole.
| Compound Name | 3-(bromomethyl)-4-cyclopropyl-5-(2,2,2-trifluoroethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 115399146 |
| Molecular Formula | C8H9BrF3N3 |
| Molecular Weight | 284.08 g/mol |
| Exact Mass | 282.99 |
| IUPAC Name | 3-(bromomethyl)-4-cyclopropyl-5-(2,2,2-trifluoroethyl)-1,2,4-triazole |
| SMILES | FC(F)(F)Cc1nnc(CBr)n1C1CC1 |
| InChI | InChI=1S/C8H9BrF3N3/c9-4-7-14-13-6(3-8(10,11)12)15(7)5-1-2-5/h5H,1-4H2 |
| InChIKey | LMOHDJMIQXJYJK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.08 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|